About 4H-1,4-benzothiazine-3-thione
4H-1,4-benzothiazine-3-thione (PubChem CID 773981) has the molecular formula C8H7NS2
and a molecular weight of 181.29 g/mol. Its IUPAC name is 4H-1,4-benzothiazine-3-thione.
Molecular Properties
| Compound Name | 4H-1,4-benzothiazine-3-thione |
| PubChem CID | 773981 |
| Molecular Formula | C8H7NS2 |
| Molecular Weight | 181.29 g/mol |
| Exact Mass | 181.00 |
| IUPAC Name | 4H-1,4-benzothiazine-3-thione |
| SMILES | S=C1CSc2ccccc2N1 |
| InChI | InChI=1S/C8H7NS2/c10-8-5-11-7-4-2-1-3-6(7)9-8/h1-4H,5H2,(H,9,10) |
| InChIKey | AQWCHSYEHJCCNU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4H-1,4-benzothiazine-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-1,4-benzothiazine-3-thione?
The IUPAC name of 4H-1,4-benzothiazine-3-thione (CID 773981) is 4H-1,4-benzothiazine-3-thione.
What is the SMILES notation for 4H-1,4-benzothiazine-3-thione?
The canonical SMILES for 4H-1,4-benzothiazine-3-thione is S=C1CSc2ccccc2N1.
What is the InChIKey of 4H-1,4-benzothiazine-3-thione?
The InChIKey is AQWCHSYEHJCCNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NS2/c10-8-5-11-7-4-2-1-3-6(7)9-8/h1-4H,5H2,(H,9,10).
What are the key properties of 4H-1,4-benzothiazine-3-thione?
4H-1,4-benzothiazine-3-thione has a molecular weight of 181.29 g/mol, XLogP of 2.53, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-1,4-benzothiazine-3-thione is sourced from PubChem (CID 773981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).