C12H24N2 — CID 7740
N,N,N',N'-tetraethylbut-2-yne-1,4-diamine (PubChem CID 7740) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is N,N,N',N'-tetraethylbut-2-yne-1,4-diamine.
| Compound Name | N,N,N',N'-tetraethylbut-2-yne-1,4-diamine |
|---|---|
| PubChem CID | 7740 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N,N,N',N'-tetraethylbut-2-yne-1,4-diamine |
| SMILES | CCN(CC)CC#CCN(CC)CC |
| InChI | InChI=1S/C12H24N2/c1-5-13(6-2)11-9-10-12-14(7-3)8-4/h5-8,11-12H2,1-4H3 |
| InChIKey | ZSHOGSSMVWJOGA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|