C22H24FNO2 — CID 77401889
[3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-8-yl]-(4-methoxy-3-methylphenyl)methanone (PubChem CID 77401889) has the molecular formula C22H24FNO2 and a molecular weight of 353.44 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-8-yl]-(4-methoxy-3-methylphenyl)methanone.
| Compound Name | [3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-8-yl]-(4-methoxy-3-methylphenyl)methanone |
|---|---|
| PubChem CID | 77401889 |
| Molecular Formula | C22H24FNO2 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | [3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-8-yl]-(4-methoxy-3-methylphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2C3CCC2CC(c2ccc(F)cc2)C3)cc1C |
| InChI | InChI=1S/C22H24FNO2/c1-14-11-16(5-10-21(14)26-2)22(25)24-19-8-9-20(24)13-17(12-19)15-3-6-18(23)7-4-15/h3-7,10-11,17,19-20H,8-9,12-13H2,1-2H3 |
| InChIKey | QJNYGTUZDXPCLT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |