C20H21N7O2 — CID 77405098
2-[[5-cyano-4-methoxy-6-(quinolin-6-ylamino)pyrimidin-2-yl]amino]-3-methylbutanamide (PubChem CID 77405098) has the molecular formula C20H21N7O2 and a molecular weight of 391.44 g/mol. Its IUPAC name is 2-[[5-cyano-4-methoxy-6-(quinolin-6-ylamino)pyrimidin-2-yl]amino]-3-methylbutanamide.
| Compound Name | 2-[[5-cyano-4-methoxy-6-(quinolin-6-ylamino)pyrimidin-2-yl]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 77405098 |
| Molecular Formula | C20H21N7O2 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 2-[[5-cyano-4-methoxy-6-(quinolin-6-ylamino)pyrimidin-2-yl]amino]-3-methylbutanamide |
| SMILES | COc1nc(NC(C(N)=O)C(C)C)nc(Nc2ccc3ncccc3c2)c1C#N |
| InChI | InChI=1S/C20H21N7O2/c1-11(2)16(17(22)28)25-20-26-18(14(10-21)19(27-20)29-3)24-13-6-7-15-12(9-13)5-4-8-23-15/h4-9,11,16H,1-3H3,(H2,22,28)(H2,24,25,26,27) |
| InChIKey | UJVXIGRMWACKSF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |