C27H34N2O2 — CID 77405289
(10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12-octahydro-1H-cyclopenta[a]phenanthren-3-yl) N-ethylcarbamate (PubChem CID 77405289) has the molecular formula C27H34N2O2 and a molecular weight of 418.58 g/mol. Its IUPAC name is (10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12-octahydro-1H-cyclopenta[a]phenanthren-3-yl) N-ethylcarbamate.
| Compound Name | (10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12-octahydro-1H-cyclopenta[a]phenanthren-3-yl) N-ethylcarbamate |
|---|---|
| PubChem CID | 77405289 |
| Molecular Formula | C27H34N2O2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | (10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12-octahydro-1H-cyclopenta[a]phenanthren-3-yl) N-ethylcarbamate |
| SMILES | CCNC(=O)OC1CCC2(C)C(=CCC3C4=CC=C(c5cccnc5)C4(C)CCC32)C1 |
| InChI | InChI=1S/C27H34N2O2/c1-4-29-25(30)31-20-11-13-26(2)19(16-20)7-8-21-23-10-9-22(18-6-5-15-28-17-18)27(23,3)14-12-24(21)26/h5-7,9-10,15,17,20-21,24H,4,8,11-14,16H2,1-3H3,(H,29,30) |
| InChIKey | AIGIGJKVUXCPOQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|