C28H36FNO — CID 77405311
3-(3-ethoxy-6-ethyl-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl)-5-fluoropyridine (PubChem CID 77405311) has the molecular formula C28H36FNO and a molecular weight of 421.60 g/mol. Its IUPAC name is 3-(3-ethoxy-6-ethyl-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl)-5-fluoropyridine.
| Compound Name | 3-(3-ethoxy-6-ethyl-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl)-5-fluoropyridine |
|---|---|
| PubChem CID | 77405311 |
| Molecular Formula | C28H36FNO |
| Molecular Weight | 421.60 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | 3-(3-ethoxy-6-ethyl-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl)-5-fluoropyridine |
| SMILES | CCOC1=CC2=C(CC)CC3C4CC=C(c5cncc(F)c5)C4(C)CCC3C2(C)CC1 |
| InChI | InChI=1S/C28H36FNO/c1-5-18-14-22-24-8-7-23(19-13-20(29)17-30-16-19)27(24,3)12-10-25(22)28(4)11-9-21(31-6-2)15-26(18)28/h7,13,15-17,22,24-25H,5-6,8-12,14H2,1-4H3 |
| InChIKey | IZJTVOFXYVPFEE-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.60 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |