C25H32O2 — CID 77405780
17-hydroxy-10,13-dimethyl-6-phenyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 77405780) has the molecular formula C25H32O2 and a molecular weight of 364.53 g/mol. Its IUPAC name is 17-hydroxy-10,13-dimethyl-6-phenyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 17-hydroxy-10,13-dimethyl-6-phenyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 77405780 |
| Molecular Formula | C25H32O2 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 17-hydroxy-10,13-dimethyl-6-phenyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC12CCC(=O)C=C1C(c1ccccc1)CC1C2CCC2(C)C(O)CCC12 |
| InChI | InChI=1S/C25H32O2/c1-24-12-10-17(26)14-22(24)18(16-6-4-3-5-7-16)15-19-20-8-9-23(27)25(20,2)13-11-21(19)24/h3-7,14,18-21,23,27H,8-13,15H2,1-2H3 |
| InChIKey | QUOVYSIRPQCDMH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |