C20H18N2O4S — CID 7740686
(5Z)-1-[(3S)-1,1-dioxothiolan-3-yl]-4-methyl-2,6-dioxo-5-[(E)-3-phenylprop-2-enylidene]pyridine-3-carbonitrile (PubChem CID 7740686) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is (5Z)-1-[(3S)-1,1-dioxothiolan-3-yl]-4-methyl-2,6-dioxo-5-[(E)-3-phenylprop-2-enylidene]pyridine-3-carbonitrile.
| Compound Name | (5Z)-1-[(3S)-1,1-dioxothiolan-3-yl]-4-methyl-2,6-dioxo-5-[(E)-3-phenylprop-2-enylidene]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 7740686 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (5Z)-1-[(3S)-1,1-dioxothiolan-3-yl]-4-methyl-2,6-dioxo-5-[(E)-3-phenylprop-2-enylidene]pyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N([C@H]2CCS(=O)(=O)C2)C(=O)/C1=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C20H18N2O4S/c1-14-17(9-5-8-15-6-3-2-4-7-15)19(23)22(20(24)18(14)12-21)16-10-11-27(25,26)13-16/h2-9,16H,10-11,13H2,1H3/b8-5+,17-9-/t16-/m0/s1 |
| InChIKey | XIMUPUZPZXTEPU-JFUVEBOBSA-N |
| XLogP | 2.02 |
| TPSA | 95.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|