C16H16N8 — CID 77410364
2-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethenyl]-5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine (PubChem CID 77410364) has the molecular formula C16H16N8 and a molecular weight of 320.36 g/mol. Its IUPAC name is 2-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethenyl]-5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine.
| Compound Name | 2-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethenyl]-5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 77410364 |
| Molecular Formula | C16H16N8 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethenyl]-5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazine |
| SMILES | Cc1ncc(C)n2nc(C=Cc3nc4c(C)ncc(C)n4n3)nc12 |
| InChI | InChI=1S/C16H16N8/c1-9-7-17-11(3)15-19-13(21-23(9)15)5-6-14-20-16-12(4)18-8-10(2)24(16)22-14/h5-8H,1-4H3 |
| InChIKey | ZLEPAIUNYJMFCL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 86.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |