About N-[2-(2,3-difluorophenyl)-1,1-difluoro-3-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide
N-[2-(2,3-difluorophenyl)-1,1-difluoro-3-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide (PubChem CID 77411386) has the molecular formula C15H12F4N2O5S
and a molecular weight of 408.33 g/mol. Its IUPAC name is N-[2-(2,3-difluorophenyl)-1,1-difluoro-3-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide.
Molecular Properties
| Compound Name | N-[2-(2,3-difluorophenyl)-1,1-difluoro-3-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide |
| PubChem CID | 77411386 |
| Molecular Formula | C15H12F4N2O5S |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | N-[2-(2,3-difluorophenyl)-1,1-difluoro-3-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)NC(CO)(c1cccc(F)c1F)C(F)F |
| InChI | InChI=1S/C15H12F4N2O5S/c16-10-5-3-4-9(13(10)17)15(8-22,14(18)19)20-27(25,26)12-7-2-1-6-11(12)21(23)24/h1-7,14,20,22H,8H2 |
| InChIKey | KTFJHSFNFUCHMO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,3-difluorophenyl)-1,1-difluoro-3-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,3-difluorophenyl)-1,1-difluoro-3-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide?
The IUPAC name of N-[2-(2,3-difluorophenyl)-1,1-difluoro-3-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide (CID 77411386) is N-[2-(2,3-difluorophenyl)-1,1-difluoro-3-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide.
What is the SMILES notation for N-[2-(2,3-difluorophenyl)-1,1-difluoro-3-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide?
The canonical SMILES for N-[2-(2,3-difluorophenyl)-1,1-difluoro-3-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide is O=[N+]([O-])c1ccccc1S(=O)(=O)NC(CO)(c1cccc(F)c1F)C(F)F.
What is the InChIKey of N-[2-(2,3-difluorophenyl)-1,1-difluoro-3-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide?
The InChIKey is KTFJHSFNFUCHMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F4N2O5S/c16-10-5-3-4-9(13(10)17)15(8-22,14(18)19)20-27(25,26)12-7-2-1-6-11(12)21(23)24/h1-7,14,20,22H,8H2.
What are the key properties of N-[2-(2,3-difluorophenyl)-1,1-difluoro-3-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide?
N-[2-(2,3-difluorophenyl)-1,1-difluoro-3-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide has a molecular weight of 408.33 g/mol, XLogP of 2.30, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,3-difluorophenyl)-1,1-difluoro-3-hydroxypropan-2-yl]-2-nitrobenzenesulfonamide is sourced from PubChem (CID 77411386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).