About (4-cyanophenyl) 2-thiophen-3-ylacetate
(4-cyanophenyl) 2-thiophen-3-ylacetate (PubChem CID 7741427) has the molecular formula C13H9NO2S
and a molecular weight of 243.29 g/mol. Its IUPAC name is (4-cyanophenyl) 2-thiophen-3-ylacetate.
Molecular Properties
| Compound Name | (4-cyanophenyl) 2-thiophen-3-ylacetate |
| PubChem CID | 7741427 |
| Molecular Formula | C13H9NO2S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | (4-cyanophenyl) 2-thiophen-3-ylacetate |
| SMILES | N#Cc1ccc(OC(=O)Cc2ccsc2)cc1 |
| InChI | InChI=1S/C13H9NO2S/c14-8-10-1-3-12(4-2-10)16-13(15)7-11-5-6-17-9-11/h1-6,9H,7H2 |
| InChIKey | BUORFGIIXKIAQP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-cyanophenyl) 2-thiophen-3-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl) 2-thiophen-3-ylacetate?
The IUPAC name of (4-cyanophenyl) 2-thiophen-3-ylacetate (CID 7741427) is (4-cyanophenyl) 2-thiophen-3-ylacetate.
What is the SMILES notation for (4-cyanophenyl) 2-thiophen-3-ylacetate?
The canonical SMILES for (4-cyanophenyl) 2-thiophen-3-ylacetate is N#Cc1ccc(OC(=O)Cc2ccsc2)cc1.
What is the InChIKey of (4-cyanophenyl) 2-thiophen-3-ylacetate?
The InChIKey is BUORFGIIXKIAQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO2S/c14-8-10-1-3-12(4-2-10)16-13(15)7-11-5-6-17-9-11/h1-6,9H,7H2.
What are the key properties of (4-cyanophenyl) 2-thiophen-3-ylacetate?
(4-cyanophenyl) 2-thiophen-3-ylacetate has a molecular weight of 243.29 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl) 2-thiophen-3-ylacetate is sourced from PubChem (CID 7741427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).