C19H25N3O3 — CID 77418005
ethyl 8-cyano-2,6,6,9a-tetramethyl-7-oxo-5,5a,8,9-tetrahydro-4H-benzo[g]indazole-3-carboxylate (PubChem CID 77418005) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is ethyl 8-cyano-2,6,6,9a-tetramethyl-7-oxo-5,5a,8,9-tetrahydro-4H-benzo[g]indazole-3-carboxylate.
| Compound Name | ethyl 8-cyano-2,6,6,9a-tetramethyl-7-oxo-5,5a,8,9-tetrahydro-4H-benzo[g]indazole-3-carboxylate |
|---|---|
| PubChem CID | 77418005 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | ethyl 8-cyano-2,6,6,9a-tetramethyl-7-oxo-5,5a,8,9-tetrahydro-4H-benzo[g]indazole-3-carboxylate |
| SMILES | CCOC(=O)c1c2c(nn1C)C1(C)CC(C#N)C(=O)C(C)(C)C1CC2 |
| InChI | InChI=1S/C19H25N3O3/c1-6-25-17(24)14-12-7-8-13-18(2,3)16(23)11(10-20)9-19(13,4)15(12)21-22(14)5/h11,13H,6-9H2,1-5H3 |
| InChIKey | XEWKJNWYMFHHII-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|