C22H26N4O3 — CID 7742280
2-(1-adamantyl)-N'-[2-(4-oxoquinazolin-3-yl)acetyl]acetohydrazide (PubChem CID 7742280) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-(1-adamantyl)-N'-[2-(4-oxoquinazolin-3-yl)acetyl]acetohydrazide.
| Compound Name | 2-(1-adamantyl)-N'-[2-(4-oxoquinazolin-3-yl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 7742280 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-(1-adamantyl)-N'-[2-(4-oxoquinazolin-3-yl)acetyl]acetohydrazide |
| SMILES | O=C(Cn1cnc2ccccc2c1=O)NNC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H26N4O3/c27-19(11-22-8-14-5-15(9-22)7-16(6-14)10-22)24-25-20(28)12-26-13-23-18-4-2-1-3-17(18)21(26)29/h1-4,13-16H,5-12H2,(H,24,27)(H,25,28) |
| InChIKey | NBHYFEIZJLFWRP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|