C25H33N4O2S+ — CID 77428257
2-[N-(2-hydroxyethyl)-4-[2-[1-[4-(1-methylimidazol-2-yl)sulfanylbutyl]pyridin-1-ium-2-yl]ethenyl]anilino]ethanol (PubChem CID 77428257) has the molecular formula C25H33N4O2S+ and a molecular weight of 453.63 g/mol. Its IUPAC name is 2-[N-(2-hydroxyethyl)-4-[2-[1-[4-(1-methylimidazol-2-yl)sulfanylbutyl]pyridin-1-ium-2-yl]ethenyl]anilino]ethanol.
| Compound Name | 2-[N-(2-hydroxyethyl)-4-[2-[1-[4-(1-methylimidazol-2-yl)sulfanylbutyl]pyridin-1-ium-2-yl]ethenyl]anilino]ethanol |
|---|---|
| PubChem CID | 77428257 |
| Molecular Formula | C25H33N4O2S+ |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 2-[N-(2-hydroxyethyl)-4-[2-[1-[4-(1-methylimidazol-2-yl)sulfanylbutyl]pyridin-1-ium-2-yl]ethenyl]anilino]ethanol |
| SMILES | Cn1ccnc1SCCCC[n+]1ccccc1C=Cc1ccc(N(CCO)CCO)cc1 |
| InChI | InChI=1S/C25H33N4O2S/c1-27-16-13-26-25(27)32-21-5-4-15-28-14-3-2-6-23(28)10-7-22-8-11-24(12-9-22)29(17-19-30)18-20-31/h2-3,6-14,16,30-31H,4-5,15,17-21H2,1H3/q+1 |
| InChIKey | CYJSDVMQDLYHTA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|