C36H52FNO4 — CID 77429049
N-[(11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl)methyl]-N-[(2-fluorophenyl)methyl]acetamide (PubChem CID 77429049) has the molecular formula C36H52FNO4 and a molecular weight of 581.81 g/mol. Its IUPAC name is N-[(11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl)methyl]-N-[(2-fluorophenyl)methyl]acetamide.
| Compound Name | N-[(11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl)methyl]-N-[(2-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 77429049 |
| Molecular Formula | C36H52FNO4 |
| Molecular Weight | 581.81 g/mol |
| Exact Mass | 581.39 |
| IUPAC Name | N-[(11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl)methyl]-N-[(2-fluorophenyl)methyl]acetamide |
| SMILES | CC(=O)N(Cc1ccccc1F)CC1CC(C)C2C(O1)C(O)C1(C)C3CCC4C(C)(C)C(O)CCC45CC35CCC21C |
| InChI | InChI=1S/C36H52FNO4/c1-21-17-24(19-38(22(2)39)18-23-9-7-8-10-25(23)37)42-30-29(21)33(5)15-16-36-20-35(36)14-13-28(40)32(3,4)26(35)11-12-27(36)34(33,6)31(30)41/h7-10,21,24,26-31,40-41H,11-20H2,1-6H3 |
| InChIKey | GUXGICRYAASHKJ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.81 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |