C19H27N5O3S — CID 7743037
butyl 3-[[2-[(4-amino-5-butyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate (PubChem CID 7743037) has the molecular formula C19H27N5O3S and a molecular weight of 405.52 g/mol. Its IUPAC name is butyl 3-[[2-[(4-amino-5-butyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate.
| Compound Name | butyl 3-[[2-[(4-amino-5-butyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 7743037 |
| Molecular Formula | C19H27N5O3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | butyl 3-[[2-[(4-amino-5-butyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1cccc(NC(=O)CSc2nnc(CCCC)n2N)c1 |
| InChI | InChI=1S/C19H27N5O3S/c1-3-5-10-16-22-23-19(24(16)20)28-13-17(25)21-15-9-7-8-14(12-15)18(26)27-11-6-4-2/h7-9,12H,3-6,10-11,13,20H2,1-2H3,(H,21,25) |
| InChIKey | RUZFCSILRNDKLG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|