C7H12N2O2 — CID 77430826
2-azabicyclo[2.2.1]heptan-5-ylcarbamic acid (PubChem CID 77430826) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is 2-azabicyclo[2.2.1]heptan-5-ylcarbamic acid.
| Compound Name | 2-azabicyclo[2.2.1]heptan-5-ylcarbamic acid |
|---|---|
| PubChem CID | 77430826 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 2-azabicyclo[2.2.1]heptan-5-ylcarbamic acid |
| SMILES | O=C(O)NC1CC2CC1CN2 |
| InChI | InChI=1S/C7H12N2O2/c10-7(11)9-6-2-5-1-4(6)3-8-5/h4-6,8-9H,1-3H2,(H,10,11) |
| InChIKey | ZPXFHNRHLHESTN-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |