C16H17ClN2O — CID 77431705
3-(1-chloroethyl)-5,13-diazatetracyclo[7.7.0.02,6.012,16]hexadeca-1,6,8,10,12(16)-pentaen-8-ol (PubChem CID 77431705) has the molecular formula C16H17ClN2O and a molecular weight of 288.78 g/mol. Its IUPAC name is 3-(1-chloroethyl)-5,13-diazatetracyclo[7.7.0.02,6.012,16]hexadeca-1,6,8,10,12(16)-pentaen-8-ol.
| Compound Name | 3-(1-chloroethyl)-5,13-diazatetracyclo[7.7.0.02,6.012,16]hexadeca-1,6,8,10,12(16)-pentaen-8-ol |
|---|---|
| PubChem CID | 77431705 |
| Molecular Formula | C16H17ClN2O |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 3-(1-chloroethyl)-5,13-diazatetracyclo[7.7.0.02,6.012,16]hexadeca-1,6,8,10,12(16)-pentaen-8-ol |
| SMILES | CC(Cl)C1CNc2cc(O)c3ccc4c(c3c21)CCN4 |
| InChI | InChI=1S/C16H17ClN2O/c1-8(17)11-7-19-13-6-14(20)10-2-3-12-9(4-5-18-12)15(10)16(11)13/h2-3,6,8,11,18-20H,4-5,7H2,1H3 |
| InChIKey | IYKTYTGXAIPFHC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|