C13H20O6 — CID 77431722
6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2,3a-trimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one (PubChem CID 77431722) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is 6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2,3a-trimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one.
| Compound Name | 6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2,3a-trimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 77431722 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2,3a-trimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one |
| SMILES | CC1(C)OCC(C2OC(=O)C3(C)OC(C)(C)OC23)O1 |
| InChI | InChI=1S/C13H20O6/c1-11(2)15-6-7(17-11)8-9-13(5,10(14)16-8)19-12(3,4)18-9/h7-9H,6H2,1-5H3 |
| InChIKey | GRWXMIGCVRUFNZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |