C20H19N3O3S — CID 7743647
(2S)-2-(4,8-dimethylquinolin-2-yl)sulfanyl-N-(2-nitrophenyl)propanamide (PubChem CID 7743647) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is (2S)-2-(4,8-dimethylquinolin-2-yl)sulfanyl-N-(2-nitrophenyl)propanamide.
| Compound Name | (2S)-2-(4,8-dimethylquinolin-2-yl)sulfanyl-N-(2-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 7743647 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | (2S)-2-(4,8-dimethylquinolin-2-yl)sulfanyl-N-(2-nitrophenyl)propanamide |
| SMILES | Cc1cc(S[C@@H](C)C(=O)Nc2ccccc2[N+](=O)[O-])nc2c(C)cccc12 |
| InChI | InChI=1S/C20H19N3O3S/c1-12-7-6-8-15-13(2)11-18(22-19(12)15)27-14(3)20(24)21-16-9-4-5-10-17(16)23(25)26/h4-11,14H,1-3H3,(H,21,24)/t14-/m0/s1 |
| InChIKey | MRPWLNNIMWXVBE-AWEZNQCLSA-N |
| XLogP | 4.88 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|