C17H20F4N2O2 — CID 77437633
N-[4-fluoro-3-(trifluoromethyl)phenyl]-1-(oxan-4-ylmethyl)azetidine-2-carboxamide (PubChem CID 77437633) has the molecular formula C17H20F4N2O2 and a molecular weight of 360.35 g/mol. Its IUPAC name is N-[4-fluoro-3-(trifluoromethyl)phenyl]-1-(oxan-4-ylmethyl)azetidine-2-carboxamide.
| Compound Name | N-[4-fluoro-3-(trifluoromethyl)phenyl]-1-(oxan-4-ylmethyl)azetidine-2-carboxamide |
|---|---|
| PubChem CID | 77437633 |
| Molecular Formula | C17H20F4N2O2 |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-[4-fluoro-3-(trifluoromethyl)phenyl]-1-(oxan-4-ylmethyl)azetidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(C(F)(F)F)c1)C1CCN1CC1CCOCC1 |
| InChI | InChI=1S/C17H20F4N2O2/c18-14-2-1-12(9-13(14)17(19,20)21)22-16(24)15-3-6-23(15)10-11-4-7-25-8-5-11/h1-2,9,11,15H,3-8,10H2,(H,22,24) |
| InChIKey | ULFQSAXNDVAQQO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |