C29H33ClN4O — CID 77439779
1-[(4-chlorophenyl)methyl]-N-methyl-3-[3-(2-methylpyrrolidin-1-yl)propoxy]-N-phenylindazol-5-amine (PubChem CID 77439779) has the molecular formula C29H33ClN4O and a molecular weight of 489.06 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-methyl-3-[3-(2-methylpyrrolidin-1-yl)propoxy]-N-phenylindazol-5-amine.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-methyl-3-[3-(2-methylpyrrolidin-1-yl)propoxy]-N-phenylindazol-5-amine |
|---|---|
| PubChem CID | 77439779 |
| Molecular Formula | C29H33ClN4O |
| Molecular Weight | 489.06 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-methyl-3-[3-(2-methylpyrrolidin-1-yl)propoxy]-N-phenylindazol-5-amine |
| SMILES | CC1CCCN1CCCOc1nn(Cc2ccc(Cl)cc2)c2ccc(N(C)c3ccccc3)cc12 |
| InChI | InChI=1S/C29H33ClN4O/c1-22-8-6-17-33(22)18-7-19-35-29-27-20-26(32(2)25-9-4-3-5-10-25)15-16-28(27)34(31-29)21-23-11-13-24(30)14-12-23/h3-5,9-16,20,22H,6-8,17-19,21H2,1-2H3 |
| InChIKey | AXHQJJSPNCHOIP-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.06 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|