About 13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosane
13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosane (PubChem CID 77440536) has the molecular formula C18H29NO
and a molecular weight of 275.44 g/mol. Its IUPAC name is 13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosane.
Molecular Properties
| Compound Name | 13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosane |
| PubChem CID | 77440536 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosane |
| SMILES | C1CCC2C(C1)OC1CCCC3C4CCCCC4N2C13 |
| InChI | InChI=1S/C18H29NO/c1-2-8-14-12(6-1)13-7-5-11-17-18(13)19(14)15-9-3-4-10-16(15)20-17/h12-18H,1-11H2 |
| InChIKey | ARYDYHHYPALKSC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosane?
The IUPAC name of 13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosane (CID 77440536) is 13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosane.
What is the SMILES notation for 13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosane?
The canonical SMILES for 13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosane is C1CCC2C(C1)OC1CCCC3C4CCCCC4N2C13.
What is the InChIKey of 13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosane?
The InChIKey is ARYDYHHYPALKSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO/c1-2-8-14-12(6-1)13-7-5-11-17-18(13)19(14)15-9-3-4-10-16(15)20-17/h12-18H,1-11H2.
What are the key properties of 13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosane?
13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosane has a molecular weight of 275.44 g/mol, XLogP of 3.74, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosane is sourced from PubChem (CID 77440536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).