C26H44BNO3 — CID 77440563
10,16-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosane (PubChem CID 77440563) has the molecular formula C26H44BNO3 and a molecular weight of 429.45 g/mol. Its IUPAC name is 10,16-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosane.
| Compound Name | 10,16-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosane |
|---|---|
| PubChem CID | 77440563 |
| Molecular Formula | C26H44BNO3 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.34 |
| IUPAC Name | 10,16-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosane |
| SMILES | CC1CCC2C(C1)OC1CC(C)CC3C4CC(B5OC(C)(C)C(C)(C)O5)CCC4N2C13 |
| InChI | InChI=1S/C26H44BNO3/c1-15-7-9-21-22(12-15)29-23-13-16(2)11-19-18-14-17(8-10-20(18)28(21)24(19)23)27-30-25(3,4)26(5,6)31-27/h15-24H,7-14H2,1-6H3 |
| InChIKey | HVBROFZPPOXDCO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|