C21H22Cl2FN7O — CID 77441355
3-(3,5-dichloro-4-fluoroanilino)-1-[1-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]piperidin-2-one (PubChem CID 77441355) has the molecular formula C21H22Cl2FN7O and a molecular weight of 478.36 g/mol. Its IUPAC name is 3-(3,5-dichloro-4-fluoroanilino)-1-[1-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]piperidin-2-one.
| Compound Name | 3-(3,5-dichloro-4-fluoroanilino)-1-[1-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]piperidin-2-one |
|---|---|
| PubChem CID | 77441355 |
| Molecular Formula | C21H22Cl2FN7O |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 3-(3,5-dichloro-4-fluoroanilino)-1-[1-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)piperidin-3-yl]piperidin-2-one |
| SMILES | O=C1C(Nc2cc(Cl)c(F)c(Cl)c2)CCCN1C1CCCN(c2ncnc3[nH]ncc23)C1 |
| InChI | InChI=1S/C21H22Cl2FN7O/c22-15-7-12(8-16(23)18(15)24)28-17-4-2-6-31(21(17)32)13-3-1-5-30(10-13)20-14-9-27-29-19(14)25-11-26-20/h7-9,11,13,17,28H,1-6,10H2,(H,25,26,27,29) |
| InChIKey | VLVOLTIXBKSOMQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|