C25H20F3NO4 — CID 77441881
1'-[[2-(trifluoromethyl)phenyl]methyl]spiro[3,5a,7,8a-tetrahydro-2H-furo[2,3-g][1,4]benzodioxine-8,3'-indole]-2'-one (PubChem CID 77441881) has the molecular formula C25H20F3NO4 and a molecular weight of 455.43 g/mol. Its IUPAC name is 1'-[[2-(trifluoromethyl)phenyl]methyl]spiro[3,5a,7,8a-tetrahydro-2H-furo[2,3-g][1,4]benzodioxine-8,3'-indole]-2'-one.
| Compound Name | 1'-[[2-(trifluoromethyl)phenyl]methyl]spiro[3,5a,7,8a-tetrahydro-2H-furo[2,3-g][1,4]benzodioxine-8,3'-indole]-2'-one |
|---|---|
| PubChem CID | 77441881 |
| Molecular Formula | C25H20F3NO4 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 1'-[[2-(trifluoromethyl)phenyl]methyl]spiro[3,5a,7,8a-tetrahydro-2H-furo[2,3-g][1,4]benzodioxine-8,3'-indole]-2'-one |
| SMILES | O=C1N(Cc2ccccc2C(F)(F)F)c2ccccc2C12COC1C=C3OCCOC3=CC12 |
| InChI | InChI=1S/C25H20F3NO4/c26-25(27,28)16-6-2-1-5-15(16)13-29-19-8-4-3-7-17(19)24(23(29)30)14-33-20-12-22-21(11-18(20)24)31-9-10-32-22/h1-8,11-12,18,20H,9-10,13-14H2 |
| InChIKey | GKABWJYRJSWSTL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |