C25H27FN2 — CID 77444052
8-[3-(4-fluorophenyl)but-2-enyl]-6-methyl-2,3,3a,4,9,10-hexahydro-1H-indolizino[6,7-b]indole (PubChem CID 77444052) has the molecular formula C25H27FN2 and a molecular weight of 374.50 g/mol. Its IUPAC name is 8-[3-(4-fluorophenyl)but-2-enyl]-6-methyl-2,3,3a,4,9,10-hexahydro-1H-indolizino[6,7-b]indole.
| Compound Name | 8-[3-(4-fluorophenyl)but-2-enyl]-6-methyl-2,3,3a,4,9,10-hexahydro-1H-indolizino[6,7-b]indole |
|---|---|
| PubChem CID | 77444052 |
| Molecular Formula | C25H27FN2 |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 8-[3-(4-fluorophenyl)but-2-enyl]-6-methyl-2,3,3a,4,9,10-hexahydro-1H-indolizino[6,7-b]indole |
| SMILES | CC(=CCc1cc(C)cc2c3c([nH]c12)CN1CCCC1C3)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H27FN2/c1-16-12-19(6-5-17(2)18-7-9-20(26)10-8-18)25-23(13-16)22-14-21-4-3-11-28(21)15-24(22)27-25/h5,7-10,12-13,21,27H,3-4,6,11,14-15H2,1-2H3 |
| InChIKey | CXXLMIMCPQYKGL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|