C38H62N2O3 — CID 77445767
[5a,5b,8,8,11a-pentamethyl-3a-[2-(4-methylpiperazin-1-yl)acetyl]-1-propan-2-yl-2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydrocyclopenta[a]chrysen-9-yl] acetate (PubChem CID 77445767) has the molecular formula C38H62N2O3 and a molecular weight of 594.93 g/mol. Its IUPAC name is [5a,5b,8,8,11a-pentamethyl-3a-[2-(4-methylpiperazin-1-yl)acetyl]-1-propan-2-yl-2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydrocyclopenta[a]chrysen-9-yl] acetate.
| Compound Name | [5a,5b,8,8,11a-pentamethyl-3a-[2-(4-methylpiperazin-1-yl)acetyl]-1-propan-2-yl-2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydrocyclopenta[a]chrysen-9-yl] acetate |
|---|---|
| PubChem CID | 77445767 |
| Molecular Formula | C38H62N2O3 |
| Molecular Weight | 594.93 g/mol |
| Exact Mass | 594.48 |
| IUPAC Name | [5a,5b,8,8,11a-pentamethyl-3a-[2-(4-methylpiperazin-1-yl)acetyl]-1-propan-2-yl-2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydrocyclopenta[a]chrysen-9-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4=C(C(C)C)CCC4(C(=O)CN4CCN(C)CC4)CCC23C)C1(C)C |
| InChI | InChI=1S/C38H62N2O3/c1-25(2)27-12-17-38(31(42)24-40-22-20-39(9)21-23-40)19-18-36(7)28(33(27)38)10-11-30-35(6)15-14-32(43-26(3)41)34(4,5)29(35)13-16-37(30,36)8/h25,28-30,32H,10-24H2,1-9H3 |
| InChIKey | CPAFGGPRHRCRRS-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.93 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|