About 2-(2-fluoro-5-nitrophenyl)-4,4-dimethoxybutan-2-amine
2-(2-fluoro-5-nitrophenyl)-4,4-dimethoxybutan-2-amine (PubChem CID 77445832) has the molecular formula C12H17FN2O4
and a molecular weight of 272.28 g/mol. Its IUPAC name is 2-(2-fluoro-5-nitrophenyl)-4,4-dimethoxybutan-2-amine.
Molecular Properties
| Compound Name | 2-(2-fluoro-5-nitrophenyl)-4,4-dimethoxybutan-2-amine |
| PubChem CID | 77445832 |
| Molecular Formula | C12H17FN2O4 |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-(2-fluoro-5-nitrophenyl)-4,4-dimethoxybutan-2-amine |
| SMILES | COC(CC(C)(N)c1cc([N+](=O)[O-])ccc1F)OC |
| InChI | InChI=1S/C12H17FN2O4/c1-12(14,7-11(18-2)19-3)9-6-8(15(16)17)4-5-10(9)13/h4-6,11H,7,14H2,1-3H3 |
| InChIKey | RBHUYWDEXSIMJB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-fluoro-5-nitrophenyl)-4,4-dimethoxybutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluoro-5-nitrophenyl)-4,4-dimethoxybutan-2-amine?
The IUPAC name of 2-(2-fluoro-5-nitrophenyl)-4,4-dimethoxybutan-2-amine (CID 77445832) is 2-(2-fluoro-5-nitrophenyl)-4,4-dimethoxybutan-2-amine.
What is the SMILES notation for 2-(2-fluoro-5-nitrophenyl)-4,4-dimethoxybutan-2-amine?
The canonical SMILES for 2-(2-fluoro-5-nitrophenyl)-4,4-dimethoxybutan-2-amine is COC(CC(C)(N)c1cc([N+](=O)[O-])ccc1F)OC.
What is the InChIKey of 2-(2-fluoro-5-nitrophenyl)-4,4-dimethoxybutan-2-amine?
The InChIKey is RBHUYWDEXSIMJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17FN2O4/c1-12(14,7-11(18-2)19-3)9-6-8(15(16)17)4-5-10(9)13/h4-6,11H,7,14H2,1-3H3.
What are the key properties of 2-(2-fluoro-5-nitrophenyl)-4,4-dimethoxybutan-2-amine?
2-(2-fluoro-5-nitrophenyl)-4,4-dimethoxybutan-2-amine has a molecular weight of 272.28 g/mol, XLogP of 1.92, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluoro-5-nitrophenyl)-4,4-dimethoxybutan-2-amine is sourced from PubChem (CID 77445832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).