C22H20F3N5O4 — CID 77449412
3,4-dihydroxy-2'-(5-methoxy-3-pyridinyl)-6'-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]spiro[cyclopentane-1,7'-pyrrolo[3,4-b]pyridine]-5'-one (PubChem CID 77449412) has the molecular formula C22H20F3N5O4 and a molecular weight of 475.43 g/mol. Its IUPAC name is 3,4-dihydroxy-2'-(5-methoxy-3-pyridinyl)-6'-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]spiro[cyclopentane-1,7'-pyrrolo[3,4-b]pyridine]-5'-one.
| Compound Name | 3,4-dihydroxy-2'-(5-methoxy-3-pyridinyl)-6'-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]spiro[cyclopentane-1,7'-pyrrolo[3,4-b]pyridine]-5'-one |
|---|---|
| PubChem CID | 77449412 |
| Molecular Formula | C22H20F3N5O4 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 3,4-dihydroxy-2'-(5-methoxy-3-pyridinyl)-6'-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]spiro[cyclopentane-1,7'-pyrrolo[3,4-b]pyridine]-5'-one |
| SMILES | COc1cncc(-c2ccc3c(n2)C2(CC(O)C(O)C2)N(c2cnn(CC(F)(F)F)c2)C3=O)c1 |
| InChI | InChI=1S/C22H20F3N5O4/c1-34-14-4-12(7-26-9-14)16-3-2-15-19(28-16)21(5-17(31)18(32)6-21)30(20(15)33)13-8-27-29(10-13)11-22(23,24)25/h2-4,7-10,17-18,31-32H,5-6,11H2,1H3 |
| InChIKey | CENFKWDKTCLJQH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |