About CID 77450108
CID 77450108 (PubChem CID 77450108) has the molecular formula C24H35FO4
and a molecular weight of 406.54 g/mol.
Molecular Properties
| Compound Name | CID 77450108 |
| PubChem CID | 77450108 |
| Molecular Formula | C24H35FO4 |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | — |
| SMILES | C=C1CC2C(CCC3(C)C2C(F)CC32OCCO2)C2(C)CCC3(CC12)OCCO3 |
| InChI | InChI=1S/C24H35FO4/c1-15-12-16-17(21(2)6-7-23(13-18(15)21)26-8-9-27-23)4-5-22(3)20(16)19(25)14-24(22)28-10-11-29-24/h16-20H,1,4-14H2,2-3H3 |
| InChIKey | PUXPEKWVXCWSTE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 77450108 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 77450108?
The IUPAC name of CID 77450108 (CID 77450108) is not available.
What is the SMILES notation for CID 77450108?
The canonical SMILES for CID 77450108 is C=C1CC2C(CCC3(C)C2C(F)CC32OCCO2)C2(C)CCC3(CC12)OCCO3.
What is the InChIKey of CID 77450108?
The InChIKey is PUXPEKWVXCWSTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H35FO4/c1-15-12-16-17(21(2)6-7-23(13-18(15)21)26-8-9-27-23)4-5-22(3)20(16)19(25)14-24(22)28-10-11-29-24/h16-20H,1,4-14H2,2-3H3.
What are the key properties of CID 77450108?
CID 77450108 has a molecular weight of 406.54 g/mol, XLogP of 4.63, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 77450108 is sourced from PubChem (CID 77450108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).