C25H42O3Si — CID 77450143
10-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 77450143) has the molecular formula C25H42O3Si and a molecular weight of 418.69 g/mol. Its IUPAC name is 10-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | 10-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 77450143 |
| Molecular Formula | C25H42O3Si |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | 10-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CC12CCC3C(CCC4CC(=O)CCC43CO[Si](C)(C)C(C)(C)C)C1CCC2=O |
| InChI | InChI=1S/C25H42O3Si/c1-23(2,3)29(5,6)28-16-25-14-11-18(26)15-17(25)7-8-19-20-9-10-22(27)24(20,4)13-12-21(19)25/h17,19-21H,7-16H2,1-6H3 |
| InChIKey | BBKLLJVEJLKMGR-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|