C20H28N6O2 — CID 77453009
(2,6-dimethylmorpholin-4-yl)-[1-(2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)azetidin-3-yl]methanone (PubChem CID 77453009) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is (2,6-dimethylmorpholin-4-yl)-[1-(2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)azetidin-3-yl]methanone.
| Compound Name | (2,6-dimethylmorpholin-4-yl)-[1-(2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)azetidin-3-yl]methanone |
|---|---|
| PubChem CID | 77453009 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (2,6-dimethylmorpholin-4-yl)-[1-(2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)azetidin-3-yl]methanone |
| SMILES | CC1CN(C(=O)C2CN(c3c4c(nc5ccnn35)CCNCC4)C2)CC(C)O1 |
| InChI | InChI=1S/C20H28N6O2/c1-13-9-25(10-14(2)28-13)20(27)15-11-24(12-15)19-16-3-6-21-7-4-17(16)23-18-5-8-22-26(18)19/h5,8,13-15,21H,3-4,6-7,9-12H2,1-2H3 |
| InChIKey | SHXDOAGJCUNMQF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |