About 4-[3-(2,4-difluorophenyl)prop-2-enoyl]-3-(2-methylpropyl)-6-thiophen-2-ylpiperazin-2-one
4-[3-(2,4-difluorophenyl)prop-2-enoyl]-3-(2-methylpropyl)-6-thiophen-2-ylpiperazin-2-one (PubChem CID 77456698) has the molecular formula C21H22F2N2O2S
and a molecular weight of 404.48 g/mol. Its IUPAC name is 4-[3-(2,4-difluorophenyl)prop-2-enoyl]-3-(2-methylpropyl)-6-thiophen-2-ylpiperazin-2-one.
Molecular Properties
| Compound Name | 4-[3-(2,4-difluorophenyl)prop-2-enoyl]-3-(2-methylpropyl)-6-thiophen-2-ylpiperazin-2-one |
| PubChem CID | 77456698 |
| Molecular Formula | C21H22F2N2O2S |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 4-[3-(2,4-difluorophenyl)prop-2-enoyl]-3-(2-methylpropyl)-6-thiophen-2-ylpiperazin-2-one |
| SMILES | CC(C)CC1C(=O)NC(c2cccs2)CN1C(=O)C=Cc1ccc(F)cc1F |
| InChI | InChI=1S/C21H22F2N2O2S/c1-13(2)10-18-21(27)24-17(19-4-3-9-28-19)12-25(18)20(26)8-6-14-5-7-15(22)11-16(14)23/h3-9,11,13,17-18H,10,12H2,1-2H3,(H,24,27) |
| InChIKey | BLHKBPSSDRTBHP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(2,4-difluorophenyl)prop-2-enoyl]-3-(2-methylpropyl)-6-thiophen-2-ylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,4-difluorophenyl)prop-2-enoyl]-3-(2-methylpropyl)-6-thiophen-2-ylpiperazin-2-one?
The IUPAC name of 4-[3-(2,4-difluorophenyl)prop-2-enoyl]-3-(2-methylpropyl)-6-thiophen-2-ylpiperazin-2-one (CID 77456698) is 4-[3-(2,4-difluorophenyl)prop-2-enoyl]-3-(2-methylpropyl)-6-thiophen-2-ylpiperazin-2-one.
What is the SMILES notation for 4-[3-(2,4-difluorophenyl)prop-2-enoyl]-3-(2-methylpropyl)-6-thiophen-2-ylpiperazin-2-one?
The canonical SMILES for 4-[3-(2,4-difluorophenyl)prop-2-enoyl]-3-(2-methylpropyl)-6-thiophen-2-ylpiperazin-2-one is CC(C)CC1C(=O)NC(c2cccs2)CN1C(=O)C=Cc1ccc(F)cc1F.
What is the InChIKey of 4-[3-(2,4-difluorophenyl)prop-2-enoyl]-3-(2-methylpropyl)-6-thiophen-2-ylpiperazin-2-one?
The InChIKey is BLHKBPSSDRTBHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22F2N2O2S/c1-13(2)10-18-21(27)24-17(19-4-3-9-28-19)12-25(18)20(26)8-6-14-5-7-15(22)11-16(14)23/h3-9,11,13,17-18H,10,12H2,1-2H3,(H,24,27).
What are the key properties of 4-[3-(2,4-difluorophenyl)prop-2-enoyl]-3-(2-methylpropyl)-6-thiophen-2-ylpiperazin-2-one?
4-[3-(2,4-difluorophenyl)prop-2-enoyl]-3-(2-methylpropyl)-6-thiophen-2-ylpiperazin-2-one has a molecular weight of 404.48 g/mol, XLogP of 4.15, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,4-difluorophenyl)prop-2-enoyl]-3-(2-methylpropyl)-6-thiophen-2-ylpiperazin-2-one is sourced from PubChem (CID 77456698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).