C22H26FN5O2S — CID 77457291
6-[5-[5-(4-fluorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-methyl-1,3-diazinan-4-one (PubChem CID 77457291) has the molecular formula C22H26FN5O2S and a molecular weight of 443.55 g/mol. Its IUPAC name is 6-[5-[5-(4-fluorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-methyl-1,3-diazinan-4-one.
| Compound Name | 6-[5-[5-(4-fluorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-methyl-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 77457291 |
| Molecular Formula | C22H26FN5O2S |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 6-[5-[5-(4-fluorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-methyl-1,3-diazinan-4-one |
| SMILES | Cc1nc(C(=O)N2CC3CN(C4CC(=O)NC(C)N4)CC3C2)c(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C22H26FN5O2S/c1-12-24-18(7-19(29)25-12)27-8-15-10-28(11-16(15)9-27)22(30)20-21(31-13(2)26-20)14-3-5-17(23)6-4-14/h3-6,12,15-16,18,24H,7-11H2,1-2H3,(H,25,29) |
| InChIKey | VRSFATHTOJDLGI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |