C16H21N2O4S- — CID 7745822
(2R)-2-[[(2S)-3-methyl-2-[(2-methylbenzoyl)amino]butanoyl]amino]-3-sulfanylpropanoate (PubChem CID 7745822) has the molecular formula C16H21N2O4S- and a molecular weight of 337.42 g/mol. Its IUPAC name is (2R)-2-[[(2S)-3-methyl-2-[(2-methylbenzoyl)amino]butanoyl]amino]-3-sulfanylpropanoate.
| Compound Name | (2R)-2-[[(2S)-3-methyl-2-[(2-methylbenzoyl)amino]butanoyl]amino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 7745822 |
| Molecular Formula | C16H21N2O4S- |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | (2R)-2-[[(2S)-3-methyl-2-[(2-methylbenzoyl)amino]butanoyl]amino]-3-sulfanylpropanoate |
| SMILES | Cc1ccccc1C(=O)N[C@H](C(=O)N[C@@H](CS)C(=O)[O-])C(C)C |
| InChI | InChI=1S/C16H22N2O4S/c1-9(2)13(15(20)17-12(8-23)16(21)22)18-14(19)11-7-5-4-6-10(11)3/h4-7,9,12-13,23H,8H2,1-3H3,(H,17,20)(H,18,19)(H,21,22)/p-1/t12-,13-/m0/s1 |
| InChIKey | PJYNOKCPLDSATB-STQMWFEESA-M |
| XLogP | -0.09 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|