About 2-(cyclohexylamino)-N-(2,5-dihydroxyphenyl)acetamide
2-(cyclohexylamino)-N-(2,5-dihydroxyphenyl)acetamide (PubChem CID 77460995) has the molecular formula C14H20N2O3
and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-(cyclohexylamino)-N-(2,5-dihydroxyphenyl)acetamide.
Molecular Properties
| Compound Name | 2-(cyclohexylamino)-N-(2,5-dihydroxyphenyl)acetamide |
| PubChem CID | 77460995 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-(cyclohexylamino)-N-(2,5-dihydroxyphenyl)acetamide |
| SMILES | O=C(CNC1CCCCC1)Nc1cc(O)ccc1O |
| InChI | InChI=1S/C14H20N2O3/c17-11-6-7-13(18)12(8-11)16-14(19)9-15-10-4-2-1-3-5-10/h6-8,10,15,17-18H,1-5,9H2,(H,16,19) |
| InChIKey | IFGKCXKKPDHRHH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-(cyclohexylamino)-N-(2,5-dihydroxyphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexylamino)-N-(2,5-dihydroxyphenyl)acetamide?
The IUPAC name of 2-(cyclohexylamino)-N-(2,5-dihydroxyphenyl)acetamide (CID 77460995) is 2-(cyclohexylamino)-N-(2,5-dihydroxyphenyl)acetamide.
What is the SMILES notation for 2-(cyclohexylamino)-N-(2,5-dihydroxyphenyl)acetamide?
The canonical SMILES for 2-(cyclohexylamino)-N-(2,5-dihydroxyphenyl)acetamide is O=C(CNC1CCCCC1)Nc1cc(O)ccc1O.
What is the InChIKey of 2-(cyclohexylamino)-N-(2,5-dihydroxyphenyl)acetamide?
The InChIKey is IFGKCXKKPDHRHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3/c17-11-6-7-13(18)12(8-11)16-14(19)9-15-10-4-2-1-3-5-10/h6-8,10,15,17-18H,1-5,9H2,(H,16,19).
What are the key properties of 2-(cyclohexylamino)-N-(2,5-dihydroxyphenyl)acetamide?
2-(cyclohexylamino)-N-(2,5-dihydroxyphenyl)acetamide has a molecular weight of 264.32 g/mol, XLogP of 1.96, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexylamino)-N-(2,5-dihydroxyphenyl)acetamide is sourced from PubChem (CID 77460995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).