C35H37N3O7 — CID 77461034
N-[3-[3-(cyclohexylamino)propyl]-2,9-dioxo-1H-pyrano[2,3-f][1,4]benzoxazin-8-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide (PubChem CID 77461034) has the molecular formula C35H37N3O7 and a molecular weight of 611.70 g/mol. Its IUPAC name is N-[3-[3-(cyclohexylamino)propyl]-2,9-dioxo-1H-pyrano[2,3-f][1,4]benzoxazin-8-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide.
| Compound Name | N-[3-[3-(cyclohexylamino)propyl]-2,9-dioxo-1H-pyrano[2,3-f][1,4]benzoxazin-8-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 77461034 |
| Molecular Formula | C35H37N3O7 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.26 |
| IUPAC Name | N-[3-[3-(cyclohexylamino)propyl]-2,9-dioxo-1H-pyrano[2,3-f][1,4]benzoxazin-8-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3cc4ccc5c(c4oc3=O)NC(=O)C(CCCNC3CCCCC3)O5)ccc2OC)c1 |
| InChI | InChI=1S/C35H37N3O7/c1-42-25-11-6-8-21(18-25)26-19-23(14-15-28(26)43-2)33(39)37-27-20-22-13-16-29-31(32(22)45-35(27)41)38-34(40)30(44-29)12-7-17-36-24-9-4-3-5-10-24/h6,8,11,13-16,18-20,24,30,36H,3-5,7,9-10,12,17H2,1-2H3,(H,37,39)(H,38,40) |
| InChIKey | YCQVAILDHPFTDO-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|