C32H25NO3 — CID 77461524
4,5-bis(4-methoxyphenyl)-3-methyl-1-phenylbenzo[cd]indol-2-one (PubChem CID 77461524) has the molecular formula C32H25NO3 and a molecular weight of 471.56 g/mol. Its IUPAC name is 4,5-bis(4-methoxyphenyl)-3-methyl-1-phenylbenzo[cd]indol-2-one.
| Compound Name | 4,5-bis(4-methoxyphenyl)-3-methyl-1-phenylbenzo[cd]indol-2-one |
|---|---|
| PubChem CID | 77461524 |
| Molecular Formula | C32H25NO3 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 4,5-bis(4-methoxyphenyl)-3-methyl-1-phenylbenzo[cd]indol-2-one |
| SMILES | COc1ccc(-c2c(C)c3c4c(cccc4c2-c2ccc(OC)cc2)N(c2ccccc2)C3=O)cc1 |
| InChI | InChI=1S/C32H25NO3/c1-20-28(21-12-16-24(35-2)17-13-21)30(22-14-18-25(36-3)19-15-22)26-10-7-11-27-31(26)29(20)32(34)33(27)23-8-5-4-6-9-23/h4-19H,1-3H3 |
| InChIKey | KEWJLTNXXMBJPI-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |