C26H34FNO5Si — CID 77462489
dibenzyl 3-[tert-butyl(dimethyl)silyl]oxy-4-fluoropyrrolidine-1,2-dicarboxylate (PubChem CID 77462489) has the molecular formula C26H34FNO5Si and a molecular weight of 487.64 g/mol. Its IUPAC name is dibenzyl 3-[tert-butyl(dimethyl)silyl]oxy-4-fluoropyrrolidine-1,2-dicarboxylate.
| Compound Name | dibenzyl 3-[tert-butyl(dimethyl)silyl]oxy-4-fluoropyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 77462489 |
| Molecular Formula | C26H34FNO5Si |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | dibenzyl 3-[tert-butyl(dimethyl)silyl]oxy-4-fluoropyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC1C(F)CN(C(=O)OCc2ccccc2)C1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H34FNO5Si/c1-26(2,3)34(4,5)33-23-21(27)16-28(25(30)32-18-20-14-10-7-11-15-20)22(23)24(29)31-17-19-12-8-6-9-13-19/h6-15,21-23H,16-18H2,1-5H3 |
| InChIKey | TWMRAGSRHXXFQA-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|