C35H40FN5O6S — CID 77463026
14-amino-18-(3-fluorophenanthridin-6-yl)oxy-N-(1-methylcyclopropyl)sulfonyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide (PubChem CID 77463026) has the molecular formula C35H40FN5O6S and a molecular weight of 677.80 g/mol. Its IUPAC name is 14-amino-18-(3-fluorophenanthridin-6-yl)oxy-N-(1-methylcyclopropyl)sulfonyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide.
| Compound Name | 14-amino-18-(3-fluorophenanthridin-6-yl)oxy-N-(1-methylcyclopropyl)sulfonyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide |
|---|---|
| PubChem CID | 77463026 |
| Molecular Formula | C35H40FN5O6S |
| Molecular Weight | 677.80 g/mol |
| Exact Mass | 677.27 |
| IUPAC Name | 14-amino-18-(3-fluorophenanthridin-6-yl)oxy-N-(1-methylcyclopropyl)sulfonyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide |
| SMILES | CC1(S(=O)(=O)NC(=O)C23CC2C=CCCCCCC(N)C(=O)N2CC(Oc4nc5cc(F)ccc5c5ccccc45)CC2C(=O)N3)CC1 |
| InChI | InChI=1S/C35H40FN5O6S/c1-34(15-16-34)48(45,46)40-33(44)35-19-21(35)9-5-3-2-4-6-12-27(37)32(43)41-20-23(18-29(41)30(42)39-35)47-31-26-11-8-7-10-24(26)25-14-13-22(36)17-28(25)38-31/h5,7-11,13-14,17,21,23,27,29H,2-4,6,12,15-16,18-20,37H2,1H3,(H,39,42)(H,40,44) |
| InChIKey | FVNZRGJTHOVFIP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 160.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.80 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|