C31H37N5O3 — CID 77464573
1-cyclopentyl-N-[(4,6-dimethyl-2-oxo-3H-pyridin-3-yl)methyl]-6-[3-[3-(methylamino)propoxy]phenyl]indazole-4-carboxamide (PubChem CID 77464573) has the molecular formula C31H37N5O3 and a molecular weight of 527.67 g/mol. Its IUPAC name is 1-cyclopentyl-N-[(4,6-dimethyl-2-oxo-3H-pyridin-3-yl)methyl]-6-[3-[3-(methylamino)propoxy]phenyl]indazole-4-carboxamide.
| Compound Name | 1-cyclopentyl-N-[(4,6-dimethyl-2-oxo-3H-pyridin-3-yl)methyl]-6-[3-[3-(methylamino)propoxy]phenyl]indazole-4-carboxamide |
|---|---|
| PubChem CID | 77464573 |
| Molecular Formula | C31H37N5O3 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | 1-cyclopentyl-N-[(4,6-dimethyl-2-oxo-3H-pyridin-3-yl)methyl]-6-[3-[3-(methylamino)propoxy]phenyl]indazole-4-carboxamide |
| SMILES | CNCCCOc1cccc(-c2cc(C(=O)NCC3C(=O)N=C(C)C=C3C)c3cnn(C4CCCC4)c3c2)c1 |
| InChI | InChI=1S/C31H37N5O3/c1-20-14-21(2)35-31(38)27(20)18-33-30(37)26-16-23(22-8-6-11-25(15-22)39-13-7-12-32-3)17-29-28(26)19-34-36(29)24-9-4-5-10-24/h6,8,11,14-17,19,24,27,32H,4-5,7,9-10,12-13,18H2,1-3H3,(H,33,37) |
| InChIKey | USIZRFGALJPDTI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|