About [4-[2-(dichloromethyl)-4-(fluoromethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid
[4-[2-(dichloromethyl)-4-(fluoromethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid (PubChem CID 77465149) has the molecular formula C12H12Cl2FNO3S
and a molecular weight of 340.20 g/mol. Its IUPAC name is [4-[2-(dichloromethyl)-4-(fluoromethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid.
Molecular Properties
| Compound Name | [4-[2-(dichloromethyl)-4-(fluoromethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid |
| PubChem CID | 77465149 |
| Molecular Formula | C12H12Cl2FNO3S |
| Molecular Weight | 340.20 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | [4-[2-(dichloromethyl)-4-(fluoromethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid |
| SMILES | O=S(O)Cc1ccc(C2OC(C(Cl)Cl)=NC2CF)cc1 |
| InChI | InChI=1S/C12H12Cl2FNO3S/c13-11(14)12-16-9(5-15)10(19-12)8-3-1-7(2-4-8)6-20(17)18/h1-4,9-11H,5-6H2,(H,17,18) |
| InChIKey | MBTLGASBTBNIJB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.20 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(dichloromethyl)-4-(fluoromethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(dichloromethyl)-4-(fluoromethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid?
The IUPAC name of [4-[2-(dichloromethyl)-4-(fluoromethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid (CID 77465149) is [4-[2-(dichloromethyl)-4-(fluoromethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid.
What is the SMILES notation for [4-[2-(dichloromethyl)-4-(fluoromethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid?
The canonical SMILES for [4-[2-(dichloromethyl)-4-(fluoromethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid is O=S(O)Cc1ccc(C2OC(C(Cl)Cl)=NC2CF)cc1.
What is the InChIKey of [4-[2-(dichloromethyl)-4-(fluoromethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid?
The InChIKey is MBTLGASBTBNIJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2FNO3S/c13-11(14)12-16-9(5-15)10(19-12)8-3-1-7(2-4-8)6-20(17)18/h1-4,9-11H,5-6H2,(H,17,18).
What are the key properties of [4-[2-(dichloromethyl)-4-(fluoromethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid?
[4-[2-(dichloromethyl)-4-(fluoromethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid has a molecular weight of 340.20 g/mol, XLogP of 3.02, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(dichloromethyl)-4-(fluoromethyl)-4,5-dihydro-1,3-oxazol-5-yl]phenyl]methanesulfinic acid is sourced from PubChem (CID 77465149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).