About 1-(3-ethyl-4-methylpyrrolidin-1-yl)-2,2-difluoroethanone
1-(3-ethyl-4-methylpyrrolidin-1-yl)-2,2-difluoroethanone (PubChem CID 77465440) has the molecular formula C9H15F2NO
and a molecular weight of 191.22 g/mol. Its IUPAC name is 1-(3-ethyl-4-methylpyrrolidin-1-yl)-2,2-difluoroethanone.
Molecular Properties
| Compound Name | 1-(3-ethyl-4-methylpyrrolidin-1-yl)-2,2-difluoroethanone |
| PubChem CID | 77465440 |
| Molecular Formula | C9H15F2NO |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 1-(3-ethyl-4-methylpyrrolidin-1-yl)-2,2-difluoroethanone |
| SMILES | CCC1CN(C(=O)C(F)F)CC1C |
| InChI | InChI=1S/C9H15F2NO/c1-3-7-5-12(4-6(7)2)9(13)8(10)11/h6-8H,3-5H2,1-2H3 |
| InChIKey | WLMYXWHALZZEQH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3-ethyl-4-methylpyrrolidin-1-yl)-2,2-difluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethyl-4-methylpyrrolidin-1-yl)-2,2-difluoroethanone?
The IUPAC name of 1-(3-ethyl-4-methylpyrrolidin-1-yl)-2,2-difluoroethanone (CID 77465440) is 1-(3-ethyl-4-methylpyrrolidin-1-yl)-2,2-difluoroethanone.
What is the SMILES notation for 1-(3-ethyl-4-methylpyrrolidin-1-yl)-2,2-difluoroethanone?
The canonical SMILES for 1-(3-ethyl-4-methylpyrrolidin-1-yl)-2,2-difluoroethanone is CCC1CN(C(=O)C(F)F)CC1C.
What is the InChIKey of 1-(3-ethyl-4-methylpyrrolidin-1-yl)-2,2-difluoroethanone?
The InChIKey is WLMYXWHALZZEQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NO/c1-3-7-5-12(4-6(7)2)9(13)8(10)11/h6-8H,3-5H2,1-2H3.
What are the key properties of 1-(3-ethyl-4-methylpyrrolidin-1-yl)-2,2-difluoroethanone?
1-(3-ethyl-4-methylpyrrolidin-1-yl)-2,2-difluoroethanone has a molecular weight of 191.22 g/mol, XLogP of 1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethyl-4-methylpyrrolidin-1-yl)-2,2-difluoroethanone is sourced from PubChem (CID 77465440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).