C36H35FO5S2 — CID 77466068
3-(2-fluorophenyl)-4,7-bis-(4-methylphenyl)sulfonyl-6-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one (PubChem CID 77466068) has the molecular formula C36H35FO5S2 and a molecular weight of 630.80 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-4,7-bis-(4-methylphenyl)sulfonyl-6-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one.
| Compound Name | 3-(2-fluorophenyl)-4,7-bis-(4-methylphenyl)sulfonyl-6-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 77466068 |
| Molecular Formula | C36H35FO5S2 |
| Molecular Weight | 630.80 g/mol |
| Exact Mass | 630.19 |
| IUPAC Name | 3-(2-fluorophenyl)-4,7-bis-(4-methylphenyl)sulfonyl-6-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one |
| SMILES | Cc1ccc(S(=O)(=O)C2CC3C(=O)CC(c4ccccc4F)C(S(=O)(=O)c4ccc(C)cc4)C3CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C36H35FO5S2/c1-23-12-16-26(17-13-23)43(39,40)35-22-30-31(20-29(35)25-8-4-3-5-9-25)36(44(41,42)27-18-14-24(2)15-19-27)32(21-34(30)38)28-10-6-7-11-33(28)37/h3-19,29-32,35-36H,20-22H2,1-2H3 |
| InChIKey | FNHIDROKBZTELV-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.80 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |