C25H21ClO4 — CID 7746607
6-chloro-3-[3-(4-methylphenoxy)propoxy]-2-phenylchromen-4-one (PubChem CID 7746607) has the molecular formula C25H21ClO4 and a molecular weight of 420.89 g/mol. Its IUPAC name is 6-chloro-3-[3-(4-methylphenoxy)propoxy]-2-phenylchromen-4-one.
| Compound Name | 6-chloro-3-[3-(4-methylphenoxy)propoxy]-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 7746607 |
| Molecular Formula | C25H21ClO4 |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 6-chloro-3-[3-(4-methylphenoxy)propoxy]-2-phenylchromen-4-one |
| SMILES | Cc1ccc(OCCCOc2c(-c3ccccc3)oc3ccc(Cl)cc3c2=O)cc1 |
| InChI | InChI=1S/C25H21ClO4/c1-17-8-11-20(12-9-17)28-14-5-15-29-25-23(27)21-16-19(26)10-13-22(21)30-24(25)18-6-3-2-4-7-18/h2-4,6-13,16H,5,14-15H2,1H3 |
| InChIKey | LABRMMOBZSTVKM-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|