C36H34ClFO5S2 — CID 77466080
4-(4-chlorophenyl)sulfonyl-6-(2-fluorophenyl)-3-(4-methylphenyl)-7-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one (PubChem CID 77466080) has the molecular formula C36H34ClFO5S2 and a molecular weight of 665.25 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfonyl-6-(2-fluorophenyl)-3-(4-methylphenyl)-7-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one.
| Compound Name | 4-(4-chlorophenyl)sulfonyl-6-(2-fluorophenyl)-3-(4-methylphenyl)-7-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 77466080 |
| Molecular Formula | C36H34ClFO5S2 |
| Molecular Weight | 665.25 g/mol |
| Exact Mass | 664.15 |
| IUPAC Name | 4-(4-chlorophenyl)sulfonyl-6-(2-fluorophenyl)-3-(4-methylphenyl)-7-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one |
| SMILES | Cc1ccc(C2CC(=O)C3CC(S(=O)(=O)c4ccc(C)cc4)C(c4ccccc4F)CC3C2S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C36H34ClFO5S2/c1-22-7-11-24(12-8-22)29-20-34(39)30-21-35(44(40,41)26-15-9-23(2)10-16-26)31(28-5-3-4-6-33(28)38)19-32(30)36(29)45(42,43)27-17-13-25(37)14-18-27/h3-18,29-32,35-36H,19-21H2,1-2H3 |
| InChIKey | XRGBZAILVDGLGP-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.25 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |