About 2-O-[2-(4-bromo-2-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl 5-methylpyrrolidine-1,2-dicarboxylate
2-O-[2-(4-bromo-2-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl 5-methylpyrrolidine-1,2-dicarboxylate (PubChem CID 77466274) has the molecular formula C19H23BrFNO5
and a molecular weight of 444.30 g/mol. Its IUPAC name is 2-O-[2-(4-bromo-2-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl 5-methylpyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-[2-(4-bromo-2-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl 5-methylpyrrolidine-1,2-dicarboxylate |
| PubChem CID | 77466274 |
| Molecular Formula | C19H23BrFNO5 |
| Molecular Weight | 444.30 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 2-O-[2-(4-bromo-2-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl 5-methylpyrrolidine-1,2-dicarboxylate |
| SMILES | CC1CCC(C(=O)OCC(=O)c2ccc(Br)cc2F)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H23BrFNO5/c1-11-5-8-15(22(11)18(25)27-19(2,3)4)17(24)26-10-16(23)13-7-6-12(20)9-14(13)21/h6-7,9,11,15H,5,8,10H2,1-4H3 |
| InChIKey | QXICUTLZNNVGDM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-O-[2-(4-bromo-2-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl 5-methylpyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-[2-(4-bromo-2-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl 5-methylpyrrolidine-1,2-dicarboxylate?
The IUPAC name of 2-O-[2-(4-bromo-2-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl 5-methylpyrrolidine-1,2-dicarboxylate (CID 77466274) is 2-O-[2-(4-bromo-2-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl 5-methylpyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for 2-O-[2-(4-bromo-2-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl 5-methylpyrrolidine-1,2-dicarboxylate?
The canonical SMILES for 2-O-[2-(4-bromo-2-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl 5-methylpyrrolidine-1,2-dicarboxylate is CC1CCC(C(=O)OCC(=O)c2ccc(Br)cc2F)N1C(=O)OC(C)(C)C.
What is the InChIKey of 2-O-[2-(4-bromo-2-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl 5-methylpyrrolidine-1,2-dicarboxylate?
The InChIKey is QXICUTLZNNVGDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23BrFNO5/c1-11-5-8-15(22(11)18(25)27-19(2,3)4)17(24)26-10-16(23)13-7-6-12(20)9-14(13)21/h6-7,9,11,15H,5,8,10H2,1-4H3.
What are the key properties of 2-O-[2-(4-bromo-2-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl 5-methylpyrrolidine-1,2-dicarboxylate?
2-O-[2-(4-bromo-2-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl 5-methylpyrrolidine-1,2-dicarboxylate has a molecular weight of 444.30 g/mol, XLogP of 4.10, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-[2-(4-bromo-2-fluorophenyl)-2-oxoethyl] 1-O-tert-butyl 5-methylpyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 77466274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).