C42H55FN2O2 — CID 77467800
4-[3a-[(5-fluoro-2-pyridinyl)methylamino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid (PubChem CID 77467800) has the molecular formula C42H55FN2O2 and a molecular weight of 638.91 g/mol. Its IUPAC name is 4-[3a-[(5-fluoro-2-pyridinyl)methylamino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid.
| Compound Name | 4-[3a-[(5-fluoro-2-pyridinyl)methylamino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 77467800 |
| Molecular Formula | C42H55FN2O2 |
| Molecular Weight | 638.91 g/mol |
| Exact Mass | 638.42 |
| IUPAC Name | 4-[3a-[(5-fluoro-2-pyridinyl)methylamino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
| SMILES | C=C(C)C1CCC2(NCc3ccc(F)cn3)CCC3(C)C(CCC4C5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C42H55FN2O2/c1-26(2)31-16-21-42(45-25-30-13-12-29(43)24-44-30)23-22-40(6)33(36(31)42)14-15-35-39(5)19-17-32(27-8-10-28(11-9-27)37(46)47)38(3,4)34(39)18-20-41(35,40)7/h8-13,17,24,31,33-36,45H,1,14-16,18-23,25H2,2-7H3,(H,46,47) |
| InChIKey | MCVVWCXSCNPFMG-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.91 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|