About CID 77472880
CID 77472880 (PubChem CID 77472880) has the molecular formula C22H34O6
and a molecular weight of 394.51 g/mol.
Molecular Properties
| Compound Name | CID 77472880 |
| PubChem CID | 77472880 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | — |
| SMILES | CC1(CCC(=O)O)C2CCC3(C)C(CCC34OCCO4)C2CCC12OCCO2 |
| InChI | InChI=1S/C22H34O6/c1-19-7-4-16-15(17(19)5-10-22(19)27-13-14-28-22)3-9-21(25-11-12-26-21)20(16,2)8-6-18(23)24/h15-17H,3-14H2,1-2H3,(H,23,24) |
| InChIKey | BSQCLLCDMKKNOS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 77472880 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 77472880?
The IUPAC name of CID 77472880 (CID 77472880) is not available.
What is the SMILES notation for CID 77472880?
The canonical SMILES for CID 77472880 is CC1(CCC(=O)O)C2CCC3(C)C(CCC34OCCO4)C2CCC12OCCO2.
What is the InChIKey of CID 77472880?
The InChIKey is BSQCLLCDMKKNOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34O6/c1-19-7-4-16-15(17(19)5-10-22(19)27-13-14-28-22)3-9-21(25-11-12-26-21)20(16,2)8-6-18(23)24/h15-17H,3-14H2,1-2H3,(H,23,24).
What are the key properties of CID 77472880?
CID 77472880 has a molecular weight of 394.51 g/mol, XLogP of 3.58, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 77472880 is sourced from PubChem (CID 77472880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).